C7H13NO3 — CID 125424433
(2S,4S)-4-methoxy-2-methylpyrrolidine-2-carboxylic acid (PubChem CID 125424433) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2S,4S)-4-methoxy-2-methylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-methoxy-2-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 125424433 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2S,4S)-4-methoxy-2-methylpyrrolidine-2-carboxylic acid |
| SMILES | CO[C@@H]1CN[C@](C)(C(=O)O)C1 |
| InChI | InChI=1S/C7H13NO3/c1-7(6(9)10)3-5(11-2)4-8-7/h5,8H,3-4H2,1-2H3,(H,9,10)/t5-,7-/m0/s1 |
| InChIKey | TYVCPOBAXSUEEH-FSPLSTOPSA-N |
| XLogP | -0.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |