C9H11BrN2O — CID 125425806
4-bromo-1-methyl-5-[(1R,5R)-6-oxabicyclo[3.1.0]hexan-1-yl]pyrazole (PubChem CID 125425806) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is 4-bromo-1-methyl-5-[(1R,5R)-6-oxabicyclo[3.1.0]hexan-1-yl]pyrazole.
| Compound Name | 4-bromo-1-methyl-5-[(1R,5R)-6-oxabicyclo[3.1.0]hexan-1-yl]pyrazole |
|---|---|
| PubChem CID | 125425806 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4-bromo-1-methyl-5-[(1R,5R)-6-oxabicyclo[3.1.0]hexan-1-yl]pyrazole |
| SMILES | Cn1ncc(Br)c1[C@]12CCC[C@H]1O2 |
| InChI | InChI=1S/C9H11BrN2O/c1-12-8(6(10)5-11-12)9-4-2-3-7(9)13-9/h5,7H,2-4H2,1H3/t7-,9+/m1/s1 |
| InChIKey | BYGMLRWMFVRLPM-APPZFPTMSA-N |
| XLogP | 1.96 |
| TPSA | 30.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|