C11H15BrN2O — CID 125426870
4-bromo-1-methyl-5-[(1S,4R,6R)-4-methyl-7-oxabicyclo[4.1.0]heptan-1-yl]pyrazole (PubChem CID 125426870) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 4-bromo-1-methyl-5-[(1S,4R,6R)-4-methyl-7-oxabicyclo[4.1.0]heptan-1-yl]pyrazole.
| Compound Name | 4-bromo-1-methyl-5-[(1S,4R,6R)-4-methyl-7-oxabicyclo[4.1.0]heptan-1-yl]pyrazole |
|---|---|
| PubChem CID | 125426870 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4-bromo-1-methyl-5-[(1S,4R,6R)-4-methyl-7-oxabicyclo[4.1.0]heptan-1-yl]pyrazole |
| SMILES | C[C@@H]1CC[C@@]2(c3c(Br)cnn3C)O[C@@H]2C1 |
| InChI | InChI=1S/C11H15BrN2O/c1-7-3-4-11(9(5-7)15-11)10-8(12)6-13-14(10)2/h6-7,9H,3-5H2,1-2H3/t7-,9-,11-/m1/s1 |
| InChIKey | ODVDREMNRJKVIZ-BCMRRPTOSA-N |
| XLogP | 2.60 |
| TPSA | 30.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|