C13H17BrO — CID 125425810
cis-(1S,3S)-1-(2-bromophenyl)-3-methylcyclohexan-1-ol (PubChem CID 125425810) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is cis-(1S,3S)-1-(2-bromophenyl)-3-methylcyclohexan-1-ol.
| Compound Name | cis-(1S,3S)-1-(2-bromophenyl)-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 125425810 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | cis-(1S,3S)-1-(2-bromophenyl)-3-methylcyclohexan-1-ol |
| SMILES | C[C@H]1CCC[C@@](O)(c2ccccc2Br)C1 |
| InChI | InChI=1S/C13H17BrO/c1-10-5-4-8-13(15,9-10)11-6-2-3-7-12(11)14/h2-3,6-7,10,15H,4-5,8-9H2,1H3/t10-,13-/m0/s1 |
| InChIKey | CBNWRLJTBYMBBX-GWCFXTLKSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |