(3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid

C10H21NO2 — CID 125427142

IUPAC(3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid
SMILESCC[C@H](C)[C@H](N)C[C@@H](C)CC(=O)O
InChIInChI=1S/C10H21NO2/c1-4-8(3)9(11)5-7(2)6-10(12)13/h7-9H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+,9-/m1/s1
InChIKeyWIOJJRRCTRYDJF-HRDYMLBCSA-N
MW187.28 g/mol
LogP1.86
Rot. Bonds6

About (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid

(3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid (PubChem CID 125427142) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid.

Molecular Properties

Compound Name(3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid
PubChem CID125427142
Molecular FormulaC10H21NO2
Molecular Weight187.28 g/mol
Exact Mass187.16
IUPAC Name(3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid
SMILESCC[C@H](C)[C@H](N)C[C@@H](C)CC(=O)O
InChIInChI=1S/C10H21NO2/c1-4-8(3)9(11)5-7(2)6-10(12)13/h7-9H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+,9-/m1/s1
InChIKeyWIOJJRRCTRYDJF-HRDYMLBCSA-N
XLogP1.86
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.28
LogP ≤ 51.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid?
The IUPAC name of (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid (CID 125427142) is (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid.
What is the SMILES notation for (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid?
The canonical SMILES for (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid is CC[C@H](C)[C@H](N)C[C@@H](C)CC(=O)O.
What is the InChIKey of (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid?
The InChIKey is WIOJJRRCTRYDJF-HRDYMLBCSA-N. The full InChI is InChI=1S/C10H21NO2/c1-4-8(3)9(11)5-7(2)6-10(12)13/h7-9H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+,9-/m1/s1.
What are the key properties of (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid?
(3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid has a molecular weight of 187.28 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R,6S)-5-amino-3,6-dimethyloctanoic acid is sourced from PubChem (CID 125427142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).