C10H21NO2 — CID 125427143
(3R,5S,6S)-5-amino-3,6-dimethyloctanoic acid (PubChem CID 125427143) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is (3R,5S,6S)-5-amino-3,6-dimethyloctanoic acid.
| Compound Name | (3R,5S,6S)-5-amino-3,6-dimethyloctanoic acid |
|---|---|
| PubChem CID | 125427143 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (3R,5S,6S)-5-amino-3,6-dimethyloctanoic acid |
| SMILES | CC[C@H](C)[C@@H](N)C[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C10H21NO2/c1-4-8(3)9(11)5-7(2)6-10(12)13/h7-9H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+,9+/m1/s1 |
| InChIKey | WIOJJRRCTRYDJF-VGMNWLOBSA-N |
| XLogP | 1.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |