C28H29ClO10 — CID 125429420
methyl (3R)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-3-(2,4-dimethoxyphenyl)propanoate (PubChem CID 125429420) has the molecular formula C28H29ClO10 and a molecular weight of 560.98 g/mol. Its IUPAC name is methyl (3R)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-3-(2,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-3-(2,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 125429420 |
| Molecular Formula | C28H29ClO10 |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | methyl (3R)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-3-(2,4-dimethoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@@H](C1=C(O)[C@@]2(Oc3c(Cl)c(OC)cc(OC)c3C2=O)[C@H](C)CC1=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C28H29ClO10/c1-13-9-17(30)22(16(11-21(31)38-6)15-8-7-14(34-2)10-18(15)35-3)26(32)28(13)27(33)23-19(36-4)12-20(37-5)24(29)25(23)39-28/h7-8,10,12-13,16,32H,9,11H2,1-6H3/t13-,16-,28+/m1/s1 |
| InChIKey | YBQAXLGNISJVRY-NGTFFEPXSA-N |
| XLogP | 4.46 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |