C27H25ClO10 — CID 125429186
methyl (3R)-3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]propanoate (PubChem CID 125429186) has the molecular formula C27H25ClO10 and a molecular weight of 544.94 g/mol. Its IUPAC name is methyl (3R)-3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]propanoate.
| Compound Name | methyl (3R)-3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]propanoate |
|---|---|
| PubChem CID | 125429186 |
| Molecular Formula | C27H25ClO10 |
| Molecular Weight | 544.94 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | methyl (3R)-3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]propanoate |
| SMILES | COC(=O)C[C@@H](C1=C(O)[C@@]2(Oc3c(Cl)c(OC)cc(OC)c3C2=O)[C@H](C)CC1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H25ClO10/c1-12-7-15(29)21(14(9-20(30)35-4)13-5-6-16-17(8-13)37-11-36-16)25(31)27(12)26(32)22-18(33-2)10-19(34-3)23(28)24(22)38-27/h5-6,8,10,12,14,31H,7,9,11H2,1-4H3/t12-,14-,27+/m1/s1 |
| InChIKey | NNTOLVXUCOHGKE-DARGTVEUSA-N |
| XLogP | 4.17 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |