C35H42ClNO9 — CID 135640573
3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-N-nonylpropanamide (PubChem CID 135640573) has the molecular formula C35H42ClNO9 and a molecular weight of 656.17 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-N-nonylpropanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-N-nonylpropanamide |
|---|---|
| PubChem CID | 135640573 |
| Molecular Formula | C35H42ClNO9 |
| Molecular Weight | 656.17 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-[(2S,4'R)-7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl]-N-nonylpropanamide |
| SMILES | CCCCCCCCCNC(=O)CC(C1=C(O)[C@@]2(Oc3c(Cl)c(OC)cc(OC)c3C2=O)[C@H](C)CC1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H42ClNO9/c1-5-6-7-8-9-10-11-14-37-28(39)17-22(21-12-13-24-25(16-21)45-19-44-24)29-23(38)15-20(2)35(33(29)40)34(41)30-26(42-3)18-27(43-4)31(36)32(30)46-35/h12-13,16,18,20,22,40H,5-11,14-15,17,19H2,1-4H3,(H,37,39)/t20-,22?,35+/m1/s1 |
| InChIKey | HKSKJNCSQLYTNF-QGPRUUBLSA-N |
| XLogP | 6.86 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.17 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|