C30H31ClN2O10 — CID 163094169
N-(2-acetamidoethyl)-3-(1,3-benzodioxol-5-yl)-3-(7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl)propanamide (PubChem CID 163094169) has the molecular formula C30H31ClN2O10 and a molecular weight of 615.04 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-(1,3-benzodioxol-5-yl)-3-(7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl)propanamide.
| Compound Name | N-(2-acetamidoethyl)-3-(1,3-benzodioxol-5-yl)-3-(7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl)propanamide |
|---|---|
| PubChem CID | 163094169 |
| Molecular Formula | C30H31ClN2O10 |
| Molecular Weight | 615.04 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | N-(2-acetamidoethyl)-3-(1,3-benzodioxol-5-yl)-3-(7-chloro-2'-hydroxy-4,6-dimethoxy-4'-methyl-3,6'-dioxospiro[1-benzofuran-2,3'-cyclohexene]-1'-yl)propanamide |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C2=O)C(O)=C(C(CC(=O)NCCNC(C)=O)c2ccc3c(c2)OCO3)C(=O)CC1C |
| InChI | InChI=1S/C30H31ClN2O10/c1-14-9-18(35)24(28(37)30(14)29(38)25-21(39-3)12-22(40-4)26(31)27(25)43-30)17(11-23(36)33-8-7-32-15(2)34)16-5-6-19-20(10-16)42-13-41-19/h5-6,10,12,14,17,37H,7-9,11,13H2,1-4H3,(H,32,34)(H,33,36) |
| InChIKey | LGEVTNIIVPNAGJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.04 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|