C22H22ClN5O — CID 125431375
(3R)-3-(4-chlorophenyl)-3-pyrrol-1-yl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]propanamide (PubChem CID 125431375) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-pyrrol-1-yl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]propanamide.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-pyrrol-1-yl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]propanamide |
|---|---|
| PubChem CID | 125431375 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-pyrrol-1-yl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]propanamide |
| SMILES | O=C(C[C@H](c1ccc(Cl)cc1)n1cccc1)NCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C22H22ClN5O/c23-18-10-8-17(9-11-18)19(27-13-3-4-14-27)16-22(29)24-12-5-7-21-26-25-20-6-1-2-15-28(20)21/h1-4,6,8-11,13-15,19H,5,7,12,16H2,(H,24,29)/t19-/m1/s1 |
| InChIKey | MKMJGSHFGFWVAO-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|