C22H27NO3 — CID 125434955
2-methyl-2-[4-[4-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]phenoxy]propanoic acid (PubChem CID 125434955) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-methyl-2-[4-[4-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[4-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 125434955 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-methyl-2-[4-[4-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]phenoxy]propanoic acid |
| SMILES | C[C@H](c1ccc(-c2ccc(OC(C)(C)C(=O)O)cc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C22H27NO3/c1-16(23-14-4-5-15-23)17-6-8-18(9-7-17)19-10-12-20(13-11-19)26-22(2,3)21(24)25/h6-13,16H,4-5,14-15H2,1-3H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | RXWOQHNHSXFVRG-MRXNPFEDSA-N |
| XLogP | 4.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |