C23H24N4O — CID 125436432
[3-[5-(imidazol-1-ylmethyl)-2-pyridinyl]phenyl]-[(2S)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone (PubChem CID 125436432) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is [3-[5-(imidazol-1-ylmethyl)-2-pyridinyl]phenyl]-[(2S)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone.
| Compound Name | [3-[5-(imidazol-1-ylmethyl)-2-pyridinyl]phenyl]-[(2S)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 125436432 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [3-[5-(imidazol-1-ylmethyl)-2-pyridinyl]phenyl]-[(2S)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone |
| SMILES | CC(C)[C@H]1C=CCN1C(=O)c1cccc(-c2ccc(Cn3ccnc3)cn2)c1 |
| InChI | InChI=1S/C23H24N4O/c1-17(2)22-7-4-11-27(22)23(28)20-6-3-5-19(13-20)21-9-8-18(14-25-21)15-26-12-10-24-16-26/h3-10,12-14,16-17,22H,11,15H2,1-2H3/t22-/m1/s1 |
| InChIKey | ITXFVNJKWXVXBY-JOCHJYFZSA-N |
| XLogP | 4.03 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|