C21H22N4O — CID 70723601
[1-[5-(imidazol-1-ylmethyl)-2-pyridinyl]piperidin-3-yl]-phenylmethanone (PubChem CID 70723601) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is [1-[5-(imidazol-1-ylmethyl)-2-pyridinyl]piperidin-3-yl]-phenylmethanone.
| Compound Name | [1-[5-(imidazol-1-ylmethyl)-2-pyridinyl]piperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 70723601 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [1-[5-(imidazol-1-ylmethyl)-2-pyridinyl]piperidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCCN(c2ccc(Cn3ccnc3)cn2)C1 |
| InChI | InChI=1S/C21H22N4O/c26-21(18-5-2-1-3-6-18)19-7-4-11-25(15-19)20-9-8-17(13-23-20)14-24-12-10-22-16-24/h1-3,5-6,8-10,12-13,16,19H,4,7,11,14-15H2 |
| InChIKey | UQECGNCFJPQDOT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |