C15H24N4O2S — CID 125436471
1-[2-(dimethylamino)ethyl]-3-[(3R)-2-oxopiperidin-3-yl]-1-(thiophen-3-ylmethyl)urea (PubChem CID 125436471) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[(3R)-2-oxopiperidin-3-yl]-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[(3R)-2-oxopiperidin-3-yl]-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 125436471 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[(3R)-2-oxopiperidin-3-yl]-1-(thiophen-3-ylmethyl)urea |
| SMILES | CN(C)CCN(Cc1ccsc1)C(=O)N[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C15H24N4O2S/c1-18(2)7-8-19(10-12-5-9-22-11-12)15(21)17-13-4-3-6-16-14(13)20/h5,9,11,13H,3-4,6-8,10H2,1-2H3,(H,16,20)(H,17,21)/t13-/m1/s1 |
| InChIKey | DYUNEQMNODTMCE-CYBMUJFWSA-N |
| XLogP | 1.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |