C16H21N3O4 — CID 94030634
1-(1,3-benzodioxol-5-ylmethyl)-1-methyl-3-[(3R)-2-oxoazepan-3-yl]urea (PubChem CID 94030634) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-methyl-3-[(3R)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-methyl-3-[(3R)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 94030634 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-methyl-3-[(3R)-2-oxoazepan-3-yl]urea |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C16H21N3O4/c1-19(9-11-5-6-13-14(8-11)23-10-22-13)16(21)18-12-4-2-3-7-17-15(12)20/h5-6,8,12H,2-4,7,9-10H2,1H3,(H,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | XDJZIEUABLGYHV-GFCCVEGCSA-N |
| XLogP | 1.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |