C16H21N3O4 — CID 51083748
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoazepan-3-yl)urea (PubChem CID 51083748) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoazepan-3-yl)urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoazepan-3-yl)urea |
|---|---|
| PubChem CID | 51083748 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2-oxoazepan-3-yl)urea |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)NC1CCCCNC1=O |
| InChI | InChI=1S/C16H21N3O4/c20-15-12(3-1-2-7-17-15)19-16(21)18-8-6-11-4-5-13-14(9-11)23-10-22-13/h4-5,9,12H,1-3,6-8,10H2,(H,17,20)(H2,18,19,21) |
| InChIKey | JYYVRSLCQHWLGY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |