C18H26N2O3 — CID 110775706
1-cyclohexyl-3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]urea (PubChem CID 110775706) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]urea |
|---|---|
| PubChem CID | 110775706 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-cyclohexyl-3-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]urea |
| SMILES | O=C(NCCc1ccc2c(c1)OCCCO2)NC1CCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-18(20-15-5-2-1-3-6-15)19-10-9-14-7-8-16-17(13-14)23-12-4-11-22-16/h7-8,13,15H,1-6,9-12H2,(H2,19,20,21) |
| InChIKey | DQVHOEXVNJHZMK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |