C22H33NO4S — CID 129295790
5-cyclohexylsulfinyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]pentanamide (PubChem CID 129295790) has the molecular formula C22H33NO4S and a molecular weight of 407.58 g/mol. Its IUPAC name is 5-cyclohexylsulfinyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]pentanamide.
| Compound Name | 5-cyclohexylsulfinyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 129295790 |
| Molecular Formula | C22H33NO4S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 5-cyclohexylsulfinyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]pentanamide |
| SMILES | O=C(CCCCS(=O)C1CCCCC1)NCCc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H33NO4S/c24-22(9-4-5-16-28(25)19-7-2-1-3-8-19)23-13-12-18-10-11-20-21(17-18)27-15-6-14-26-20/h10-11,17,19H,1-9,12-16H2,(H,23,24) |
| InChIKey | JCGYNOLSDODYSH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|