C13H18F3N3O — CID 125438590
2-[(2R)-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]morpholin-2-yl]ethanamine (PubChem CID 125438590) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-[(2R)-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]morpholin-2-yl]ethanamine.
| Compound Name | 2-[(2R)-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]morpholin-2-yl]ethanamine |
|---|---|
| PubChem CID | 125438590 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[(2R)-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]morpholin-2-yl]ethanamine |
| SMILES | NCC[C@@H]1CN(Cc2ccc(C(F)(F)F)nc2)CCO1 |
| InChI | InChI=1S/C13H18F3N3O/c14-13(15,16)12-2-1-10(7-18-12)8-19-5-6-20-11(9-19)3-4-17/h1-2,7,11H,3-6,8-9,17H2/t11-/m1/s1 |
| InChIKey | ZRWMUVGQOKYMNO-LLVKDONJSA-N |
| XLogP | 1.65 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |