C18H28N2O4 — CID 125438610
1-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-(1-methylcyclohexyl)urea (PubChem CID 125438610) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-(1-methylcyclohexyl)urea.
| Compound Name | 1-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-(1-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 125438610 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-(1-methylcyclohexyl)urea |
| SMILES | COc1ccc(OC[C@@H](O)CNC(=O)NC2(C)CCCCC2)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-18(10-4-3-5-11-18)20-17(22)19-12-14(21)13-24-16-8-6-15(23-2)7-9-16/h6-9,14,21H,3-5,10-13H2,1-2H3,(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | NKZYICZCPDIBTI-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |