C18H27ClN2O4 — CID 122560545
1-[3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-3-[1-(methoxymethyl)cyclopentyl]urea (PubChem CID 122560545) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is 1-[3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-3-[1-(methoxymethyl)cyclopentyl]urea.
| Compound Name | 1-[3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-3-[1-(methoxymethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 122560545 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-3-[1-(methoxymethyl)cyclopentyl]urea |
| SMILES | COCC1(NC(=O)NCC(O)COc2ccc(Cl)c(C)c2)CCCC1 |
| InChI | InChI=1S/C18H27ClN2O4/c1-13-9-15(5-6-16(13)19)25-11-14(22)10-20-17(23)21-18(12-24-2)7-3-4-8-18/h5-6,9,14,22H,3-4,7-8,10-12H2,1-2H3,(H2,20,21,23) |
| InChIKey | VIVXAEACVULVAB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |