C16H24ClNO3 — CID 114756306
1-(4-chloro-3-methylphenoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol (PubChem CID 114756306) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol.
| Compound Name | 1-(4-chloro-3-methylphenoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 114756306 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(4-chloro-3-methylphenoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol |
| SMILES | Cc1cc(OCC(O)CNCC2(CCO)CC2)ccc1Cl |
| InChI | InChI=1S/C16H24ClNO3/c1-12-8-14(2-3-15(12)17)21-10-13(20)9-18-11-16(4-5-16)6-7-19/h2-3,8,13,18-20H,4-7,9-11H2,1H3 |
| InChIKey | RXLUZHPLXBIZAT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |