C15H18ClN3O5 — CID 97139392
N-[(2S)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 97139392) has the molecular formula C15H18ClN3O5 and a molecular weight of 355.78 g/mol. Its IUPAC name is N-[(2S)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(2S)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 97139392 |
| Molecular Formula | C15H18ClN3O5 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[(2S)-3-(4-chloro-3-methylphenoxy)-2-hydroxypropyl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | Cc1cc(OC[C@@H](O)CNC(=O)CN2C(=O)CNC2=O)ccc1Cl |
| InChI | InChI=1S/C15H18ClN3O5/c1-9-4-11(2-3-12(9)16)24-8-10(20)5-17-13(21)7-19-14(22)6-18-15(19)23/h2-4,10,20H,5-8H2,1H3,(H,17,21)(H,18,23)/t10-/m0/s1 |
| InChIKey | WPWNPWPZRJTDBT-JTQLQIEISA-N |
| XLogP | 0.06 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|