C19H25N3O2 — CID 125438742
4-(1,3-dimethylpyrazol-4-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide (PubChem CID 125438742) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide.
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 125438742 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide |
| SMILES | Cc1nn(C)cc1-c1ccc(C(=O)NCCC[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-14-18(12-22(2)21-14)16-5-7-17(8-6-16)19(23)20-10-3-4-15-9-11-24-13-15/h5-8,12,15H,3-4,9-11,13H2,1-2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | SSRXRPQJPXEZTG-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|