C20H25N3O4 — CID 126448906
3-(4,6-dimethoxypyrimidin-2-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide (PubChem CID 126448906) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide.
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 126448906 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)-N-[3-[(3S)-oxolan-3-yl]propyl]benzamide |
| SMILES | COc1cc(OC)nc(-c2cccc(C(=O)NCCC[C@H]3CCOC3)c2)n1 |
| InChI | InChI=1S/C20H25N3O4/c1-25-17-12-18(26-2)23-19(22-17)15-6-3-7-16(11-15)20(24)21-9-4-5-14-8-10-27-13-14/h3,6-7,11-12,14H,4-5,8-10,13H2,1-2H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | AYCMVFHZDXMBGH-AWEZNQCLSA-N |
| XLogP | 2.71 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|