C22H24N2O3 — CID 126452642
3-(2-ethyl-1,3-benzoxazol-5-yl)-N-[2-[(3R)-oxolan-3-yl]ethyl]benzamide (PubChem CID 126452642) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-(2-ethyl-1,3-benzoxazol-5-yl)-N-[2-[(3R)-oxolan-3-yl]ethyl]benzamide.
| Compound Name | 3-(2-ethyl-1,3-benzoxazol-5-yl)-N-[2-[(3R)-oxolan-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126452642 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(2-ethyl-1,3-benzoxazol-5-yl)-N-[2-[(3R)-oxolan-3-yl]ethyl]benzamide |
| SMILES | CCc1nc2cc(-c3cccc(C(=O)NCC[C@@H]4CCOC4)c3)ccc2o1 |
| InChI | InChI=1S/C22H24N2O3/c1-2-21-24-19-13-17(6-7-20(19)27-21)16-4-3-5-18(12-16)22(25)23-10-8-15-9-11-26-14-15/h3-7,12-13,15H,2,8-11,14H2,1H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | OWMGDHKOTFBIHF-OAHLLOKOSA-N |
| XLogP | 4.21 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |