C22H25N3O2 — CID 125444929
3-(1,5-dimethylindazol-3-yl)-N-[2-[(3S)-oxolan-3-yl]ethyl]benzamide (PubChem CID 125444929) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(1,5-dimethylindazol-3-yl)-N-[2-[(3S)-oxolan-3-yl]ethyl]benzamide.
| Compound Name | 3-(1,5-dimethylindazol-3-yl)-N-[2-[(3S)-oxolan-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 125444929 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-(1,5-dimethylindazol-3-yl)-N-[2-[(3S)-oxolan-3-yl]ethyl]benzamide |
| SMILES | Cc1ccc2c(c1)c(-c1cccc(C(=O)NCC[C@H]3CCOC3)c1)nn2C |
| InChI | InChI=1S/C22H25N3O2/c1-15-6-7-20-19(12-15)21(24-25(20)2)17-4-3-5-18(13-17)22(26)23-10-8-16-9-11-27-14-16/h3-7,12-13,16H,8-11,14H2,1-2H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | WQMBBKGJEQQOMC-INIZCTEOSA-N |
| XLogP | 3.71 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |