C19H29N3O4 — CID 125439285
(6S)-4-acetyl-6-hydroxy-N-[2-(4-propylphenoxy)ethyl]-1,4-diazepane-1-carboxamide (PubChem CID 125439285) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is (6S)-4-acetyl-6-hydroxy-N-[2-(4-propylphenoxy)ethyl]-1,4-diazepane-1-carboxamide.
| Compound Name | (6S)-4-acetyl-6-hydroxy-N-[2-(4-propylphenoxy)ethyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 125439285 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (6S)-4-acetyl-6-hydroxy-N-[2-(4-propylphenoxy)ethyl]-1,4-diazepane-1-carboxamide |
| SMILES | CCCc1ccc(OCCNC(=O)N2CCN(C(C)=O)C[C@H](O)C2)cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-3-4-16-5-7-18(8-6-16)26-12-9-20-19(25)22-11-10-21(15(2)23)13-17(24)14-22/h5-8,17,24H,3-4,9-14H2,1-2H3,(H,20,25)/t17-/m0/s1 |
| InChIKey | XJINFTQPEUKVQK-KRWDZBQOSA-N |
| XLogP | 1.25 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|