C17H19F2N3O2 — CID 125440523
4-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 125440523) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is 4-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 125440523 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | Cc1c(-c2ccc(C(=O)NC[C@@H]3CCCO3)cc2)cnn1C(F)F |
| InChI | InChI=1S/C17H19F2N3O2/c1-11-15(10-21-22(11)17(18)19)12-4-6-13(7-5-12)16(23)20-9-14-3-2-8-24-14/h4-7,10,14,17H,2-3,8-9H2,1H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | JFZRZHYPDYFJIE-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |