C11H15FN4O2 — CID 125440889
1-[(2R)-2-[[(5-fluoropyrimidin-2-yl)amino]methyl]morpholin-4-yl]ethanone (PubChem CID 125440889) has the molecular formula C11H15FN4O2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-[(2R)-2-[[(5-fluoropyrimidin-2-yl)amino]methyl]morpholin-4-yl]ethanone.
| Compound Name | 1-[(2R)-2-[[(5-fluoropyrimidin-2-yl)amino]methyl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 125440889 |
| Molecular Formula | C11H15FN4O2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[(2R)-2-[[(5-fluoropyrimidin-2-yl)amino]methyl]morpholin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@H](CNc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C11H15FN4O2/c1-8(17)16-2-3-18-10(7-16)6-15-11-13-4-9(12)5-14-11/h4-5,10H,2-3,6-7H2,1H3,(H,13,14,15)/t10-/m1/s1 |
| InChIKey | BHOGZYBLIQFTEU-SNVBAGLBSA-N |
| XLogP | 0.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |