C13H18N4O3S — CID 125163832
N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 125163832) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 125163832 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)NC[C@@H]2CN(C(C)=O)CCO2)cn1 |
| InChI | InChI=1S/C13H18N4O3S/c1-9(18)17-3-4-20-11(8-17)7-14-12(19)10-5-15-13(21-2)16-6-10/h5-6,11H,3-4,7-8H2,1-2H3,(H,14,19)/t11-/m1/s1 |
| InChIKey | ZLWPZLUYDCSYEZ-LLVKDONJSA-N |
| XLogP | 0.18 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |