C18H21N5O3 — CID 126423943
N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-4-(6-aminopyrimidin-4-yl)benzamide (PubChem CID 126423943) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-4-(6-aminopyrimidin-4-yl)benzamide.
| Compound Name | N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-4-(6-aminopyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 126423943 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-4-(6-aminopyrimidin-4-yl)benzamide |
| SMILES | CC(=O)N1CCO[C@H](CNC(=O)c2ccc(-c3cc(N)ncn3)cc2)C1 |
| InChI | InChI=1S/C18H21N5O3/c1-12(24)23-6-7-26-15(10-23)9-20-18(25)14-4-2-13(3-5-14)16-8-17(19)22-11-21-16/h2-5,8,11,15H,6-7,9-10H2,1H3,(H,20,25)(H2,19,21,22)/t15-/m1/s1 |
| InChIKey | ATCPTHHMCJUPNJ-OAHLLOKOSA-N |
| XLogP | 0.70 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |