C26H26N2O5 — CID 58933856
(4-phenylphenyl)methyl (2R)-2-[[(4-hydroxybenzoyl)amino]methyl]morpholine-4-carboxylate (PubChem CID 58933856) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (4-phenylphenyl)methyl (2R)-2-[[(4-hydroxybenzoyl)amino]methyl]morpholine-4-carboxylate.
| Compound Name | (4-phenylphenyl)methyl (2R)-2-[[(4-hydroxybenzoyl)amino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 58933856 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (4-phenylphenyl)methyl (2R)-2-[[(4-hydroxybenzoyl)amino]methyl]morpholine-4-carboxylate |
| SMILES | O=C(NC[C@@H]1CN(C(=O)OCc2ccc(-c3ccccc3)cc2)CCO1)c1ccc(O)cc1 |
| InChI | InChI=1S/C26H26N2O5/c29-23-12-10-22(11-13-23)25(30)27-16-24-17-28(14-15-32-24)26(31)33-18-19-6-8-21(9-7-19)20-4-2-1-3-5-20/h1-13,24,29H,14-18H2,(H,27,30)/t24-/m1/s1 |
| InChIKey | VGLQJEKTAOQNJC-XMMPIXPASA-N |
| XLogP | 3.83 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |