C20H23N3O5 — CID 142176899
pyridin-4-ylmethyl 2-[2-[[(4-hydroxybenzoyl)amino]methyl]morpholin-4-yl]acetate (PubChem CID 142176899) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is pyridin-4-ylmethyl 2-[2-[[(4-hydroxybenzoyl)amino]methyl]morpholin-4-yl]acetate.
| Compound Name | pyridin-4-ylmethyl 2-[2-[[(4-hydroxybenzoyl)amino]methyl]morpholin-4-yl]acetate |
|---|---|
| PubChem CID | 142176899 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | pyridin-4-ylmethyl 2-[2-[[(4-hydroxybenzoyl)amino]methyl]morpholin-4-yl]acetate |
| SMILES | O=C(CN1CCOC(CNC(=O)c2ccc(O)cc2)C1)OCc1ccncc1 |
| InChI | InChI=1S/C20H23N3O5/c24-17-3-1-16(2-4-17)20(26)22-11-18-12-23(9-10-27-18)13-19(25)28-14-15-5-7-21-8-6-15/h1-8,18,24H,9-14H2,(H,22,26) |
| InChIKey | NVESFBVHJZGZLX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |