C14H20F3N5 — CID 125441360
(3S)-1-[2-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-amine (PubChem CID 125441360) has the molecular formula C14H20F3N5 and a molecular weight of 315.34 g/mol. Its IUPAC name is (3S)-1-[2-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-amine.
| Compound Name | (3S)-1-[2-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 125441360 |
| Molecular Formula | C14H20F3N5 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (3S)-1-[2-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-amine |
| SMILES | N[C@H]1CCCN(c2cc(C(F)(F)F)nc(N3CCCC3)n2)C1 |
| InChI | InChI=1S/C14H20F3N5/c15-14(16,17)11-8-12(22-7-3-4-10(18)9-22)20-13(19-11)21-5-1-2-6-21/h8,10H,1-7,9,18H2/t10-/m0/s1 |
| InChIKey | DFTDJXRGIOHLSN-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |