C21H20N4O3 — CID 125441982
3-[4-[(9aR)-9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonyl]phenyl]-4-hydroxybenzonitrile (PubChem CID 125441982) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[4-[(9aR)-9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonyl]phenyl]-4-hydroxybenzonitrile.
| Compound Name | 3-[4-[(9aR)-9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonyl]phenyl]-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 125441982 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-[4-[(9aR)-9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonyl]phenyl]-4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)c(-c2ccc(C(=O)N3CCN4CCNC(=O)[C@H]4C3)cc2)c1 |
| InChI | InChI=1S/C21H20N4O3/c22-12-14-1-6-19(26)17(11-14)15-2-4-16(5-3-15)21(28)25-10-9-24-8-7-23-20(27)18(24)13-25/h1-6,11,18,26H,7-10,13H2,(H,23,27)/t18-/m1/s1 |
| InChIKey | GDMNDUOPQHYVQV-GOSISDBHSA-N |
| XLogP | 1.19 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |