C18H23N3O2 — CID 125442859
4,6-dimethoxy-2-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]pyrimidine (PubChem CID 125442859) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4,6-dimethoxy-2-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]pyrimidine.
| Compound Name | 4,6-dimethoxy-2-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 125442859 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4,6-dimethoxy-2-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]pyrimidine |
| SMILES | COc1cc(OC)nc(-c2cccc([C@@H](C)N3CCCC3)c2)n1 |
| InChI | InChI=1S/C18H23N3O2/c1-13(21-9-4-5-10-21)14-7-6-8-15(11-14)18-19-16(22-2)12-17(20-18)23-3/h6-8,11-13H,4-5,9-10H2,1-3H3/t13-/m1/s1 |
| InChIKey | RYKZEGPUIVNQGO-CYBMUJFWSA-N |
| XLogP | 3.32 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |