C18H26N4O2 — CID 172896626
5-ethyl-1-methyl-3-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1,2,4-triazole;formic acid (PubChem CID 172896626) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-ethyl-1-methyl-3-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1,2,4-triazole;formic acid.
| Compound Name | 5-ethyl-1-methyl-3-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1,2,4-triazole;formic acid |
|---|---|
| PubChem CID | 172896626 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 5-ethyl-1-methyl-3-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1,2,4-triazole;formic acid |
| SMILES | CCc1nc(-c2cccc(C(C)N3CCCC3)c2)nn1C.O=CO |
| InChI | InChI=1S/C17H24N4.CH2O2/c1-4-16-18-17(19-20(16)3)15-9-7-8-14(12-15)13(2)21-10-5-6-11-21;2-1-3/h7-9,12-13H,4-6,10-11H2,1-3H3;1H,(H,2,3) |
| InChIKey | ZWKRNZQDHKISID-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|