C18H22N2O3 — CID 154907704
formic acid;5-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1H-pyridin-2-one (PubChem CID 154907704) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is formic acid;5-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1H-pyridin-2-one.
| Compound Name | formic acid;5-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 154907704 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | formic acid;5-[3-(1-pyrrolidin-1-ylethyl)phenyl]-1H-pyridin-2-one |
| SMILES | CC(c1cccc(-c2ccc(=O)[nH]c2)c1)N1CCCC1.O=CO |
| InChI | InChI=1S/C17H20N2O.CH2O2/c1-13(19-9-2-3-10-19)14-5-4-6-15(11-14)16-7-8-17(20)18-12-16;2-1-3/h4-8,11-13H,2-3,9-10H2,1H3,(H,18,20);1H,(H,2,3) |
| InChIKey | LTKDMBYGGULKQD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|