C20H24N2O2 — CID 95213267
2-(methylamino)-5-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]benzoic acid (PubChem CID 95213267) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(methylamino)-5-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]benzoic acid.
| Compound Name | 2-(methylamino)-5-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 95213267 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(methylamino)-5-[3-[(1R)-1-pyrrolidin-1-ylethyl]phenyl]benzoic acid |
| SMILES | CNc1ccc(-c2cccc([C@@H](C)N3CCCC3)c2)cc1C(=O)O |
| InChI | InChI=1S/C20H24N2O2/c1-14(22-10-3-4-11-22)15-6-5-7-16(12-15)17-8-9-19(21-2)18(13-17)20(23)24/h5-9,12-14,21H,3-4,10-11H2,1-2H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | BQISTKLSJUAVJQ-CQSZACIVSA-N |
| XLogP | 4.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |