C18H22N2O2 — CID 95220274
methyl 4-[3-[(1S)-1-pyrrolidin-1-ylethyl]phenyl]-1H-pyrrole-2-carboxylate (PubChem CID 95220274) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is methyl 4-[3-[(1S)-1-pyrrolidin-1-ylethyl]phenyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[3-[(1S)-1-pyrrolidin-1-ylethyl]phenyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 95220274 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | methyl 4-[3-[(1S)-1-pyrrolidin-1-ylethyl]phenyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc([C@H](C)N3CCCC3)c2)c[nH]1 |
| InChI | InChI=1S/C18H22N2O2/c1-13(20-8-3-4-9-20)14-6-5-7-15(10-14)16-11-17(19-12-16)18(21)22-2/h5-7,10-13,19H,3-4,8-9H2,1-2H3/t13-/m0/s1 |
| InChIKey | PSTKLMLTLSLSTK-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |