C12H22N4O2S — CID 125445860
[(3S)-1-(2-ethyl-5-methylpyrazol-3-yl)sulfonylpiperidin-3-yl]methanamine (PubChem CID 125445860) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is [(3S)-1-(2-ethyl-5-methylpyrazol-3-yl)sulfonylpiperidin-3-yl]methanamine.
| Compound Name | [(3S)-1-(2-ethyl-5-methylpyrazol-3-yl)sulfonylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 125445860 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [(3S)-1-(2-ethyl-5-methylpyrazol-3-yl)sulfonylpiperidin-3-yl]methanamine |
| SMILES | CCn1nc(C)cc1S(=O)(=O)N1CCC[C@@H](CN)C1 |
| InChI | InChI=1S/C12H22N4O2S/c1-3-16-12(7-10(2)14-16)19(17,18)15-6-4-5-11(8-13)9-15/h7,11H,3-6,8-9,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | GNRJHPYGEOMWSI-NSHDSACASA-N |
| XLogP | 0.57 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |