About [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride
[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride (PubChem CID 119998465) has the molecular formula C11H21ClN4O2S
and a molecular weight of 308.84 g/mol. Its IUPAC name is [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride |
| PubChem CID | 119998465 |
| Molecular Formula | C11H21ClN4O2S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCCC(CN)C1.Cl |
| InChI | InChI=1S/C11H20N4O2S.ClH/c1-8-11(9(2)14-13-8)18(16,17)15-5-3-4-10(6-12)7-15;/h10H,3-7,12H2,1-2H3,(H,13,14);1H |
| InChIKey | VFYIVIQXKPZHMJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride?
The IUPAC name of [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride (CID 119998465) is [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride.
What is the SMILES notation for [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride?
The canonical SMILES for [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride is Cc1n[nH]c(C)c1S(=O)(=O)N1CCCC(CN)C1.Cl.
What is the InChIKey of [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride?
The InChIKey is VFYIVIQXKPZHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2S.ClH/c1-8-11(9(2)14-13-8)18(16,17)15-5-3-4-10(6-12)7-15;/h10H,3-7,12H2,1-2H3,(H,13,14);1H.
What are the key properties of [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride?
[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride has a molecular weight of 308.84 g/mol, XLogP of 0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-yl]methanamine;hydrochloride is sourced from PubChem (CID 119998465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).