C12H20BrN3O2S — CID 80674526
3-(2-bromoethyl)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine (PubChem CID 80674526) has the molecular formula C12H20BrN3O2S and a molecular weight of 350.28 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine.
| Compound Name | 3-(2-bromoethyl)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine |
|---|---|
| PubChem CID | 80674526 |
| Molecular Formula | C12H20BrN3O2S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-(2-bromoethyl)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCCC(CCBr)C1 |
| InChI | InChI=1S/C12H20BrN3O2S/c1-9-12(10(2)15-14-9)19(17,18)16-7-3-4-11(8-16)5-6-13/h11H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | GXASTAKGYOGONZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|