C16H19N5OS — CID 125446947
N-[(1S)-1-(1-methylbenzimidazol-2-yl)ethyl]-4-propylthiadiazole-5-carboxamide (PubChem CID 125446947) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[(1S)-1-(1-methylbenzimidazol-2-yl)ethyl]-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-(1-methylbenzimidazol-2-yl)ethyl]-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 125446947 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(1S)-1-(1-methylbenzimidazol-2-yl)ethyl]-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)N[C@@H](C)c1nc2ccccc2n1C |
| InChI | InChI=1S/C16H19N5OS/c1-4-7-12-14(23-20-19-12)16(22)17-10(2)15-18-11-8-5-6-9-13(11)21(15)3/h5-6,8-10H,4,7H2,1-3H3,(H,17,22)/t10-/m0/s1 |
| InChIKey | CPBITNMQKUWYJN-JTQLQIEISA-N |
| XLogP | 2.87 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |