About (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide
(5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 125447128) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide |
| PubChem CID | 125447128 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC1=NO[C@@](C)(C(=O)NCC2(COc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C17H22N2O3/c1-13-10-16(2,22-19-13)15(20)18-11-17(8-9-17)12-21-14-6-4-3-5-7-14/h3-7H,8-12H2,1-2H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | YOODJEIMLUBTGD-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide?
The IUPAC name of (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide (CID 125447128) is (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide.
What is the SMILES notation for (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide?
The canonical SMILES for (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide is CC1=NO[C@@](C)(C(=O)NCC2(COc3ccccc3)CC2)C1.
What is the InChIKey of (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide?
The InChIKey is YOODJEIMLUBTGD-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-13-10-16(2,22-19-13)15(20)18-11-17(8-9-17)12-21-14-6-4-3-5-7-14/h3-7H,8-12H2,1-2H3,(H,18,20)/t16-/m1/s1.
What are the key properties of (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide?
(5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide has a molecular weight of 302.37 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,5-dimethyl-N-[[1-(phenoxymethyl)cyclopropyl]methyl]-4H-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 125447128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).