C17H26ClN3O3 — CID 125447273
1-[(2-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea (PubChem CID 125447273) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 125447273 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea |
| SMILES | C[C@@H](CN1CCOCC1)NC(=O)N(CCO)Cc1ccccc1Cl |
| InChI | InChI=1S/C17H26ClN3O3/c1-14(12-20-7-10-24-11-8-20)19-17(23)21(6-9-22)13-15-4-2-3-5-16(15)18/h2-5,14,22H,6-13H2,1H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | OFASQDJZYMCZQX-AWEZNQCLSA-N |
| XLogP | 1.56 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |