C19H28FN3O2 — CID 97224410
1-cyclobutyl-1-[(2-fluorophenyl)methyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea (PubChem CID 97224410) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-cyclobutyl-1-[(2-fluorophenyl)methyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea.
| Compound Name | 1-cyclobutyl-1-[(2-fluorophenyl)methyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 97224410 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-cyclobutyl-1-[(2-fluorophenyl)methyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea |
| SMILES | C[C@@H](CN1CCOCC1)NC(=O)N(Cc1ccccc1F)C1CCC1 |
| InChI | InChI=1S/C19H28FN3O2/c1-15(13-22-9-11-25-12-10-22)21-19(24)23(17-6-4-7-17)14-16-5-2-3-8-18(16)20/h2-3,5,8,15,17H,4,6-7,9-14H2,1H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | RUMJZMFVXWLZLA-HNNXBMFYSA-N |
| XLogP | 2.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |