About (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide
(3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide (PubChem CID 125449083) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide.
Molecular Properties
| Compound Name | (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide |
| PubChem CID | 125449083 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide |
| SMILES | NC(=NO)[C@H]1CCC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C12H15N3O2/c13-12(14-17)9-6-7-11(16)15(8-9)10-4-2-1-3-5-10/h1-5,9,17H,6-8H2,(H2,13,14)/t9-/m0/s1 |
| InChIKey | NBQRTMKSARTJAR-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide?
The IUPAC name of (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide (CID 125449083) is (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide.
What is the SMILES notation for (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide?
The canonical SMILES for (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide is NC(=NO)[C@H]1CCC(=O)N(c2ccccc2)C1.
What is the InChIKey of (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide?
The InChIKey is NBQRTMKSARTJAR-VIFPVBQESA-N. The full InChI is InChI=1S/C12H15N3O2/c13-12(14-17)9-6-7-11(16)15(8-9)10-4-2-1-3-5-10/h1-5,9,17H,6-8H2,(H2,13,14)/t9-/m0/s1.
What are the key properties of (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide?
(3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide has a molecular weight of 233.27 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N'-hydroxy-6-oxo-1-phenylpiperidine-3-carboximidamide is sourced from PubChem (CID 125449083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).